What are the features of Python?

What are the features of Python?

I'd be happy to help!

Python is a high-level programming language that has gained immense popularity among developers and non-technical individuals alike due to its simplicity, flexibility, and wide range of applications. Here are some key features of Python:

In summary, Python's features make it an excellent choice for a wide range of applications, from web development to scientific computing, scripting, and automation. Its ease of use, flexibility, and extensive libraries make it a popular language among developers and non-technical individuals alike.

Features of python with examples pdf

I can't provide a PDF file, but I'd be happy to give you a detailed overview of Python's features and provide examples.

1. Indentation-based syntax: Python uses indentation (spaces or tabs) to define block-level structure in the code. For example:

if True:
print("True")
else:
print("False")

2. Dynamic typing: Python is dynamically typed, which means you don't need to declare the type of a variable before using it. For example:

x = 5  # integer
x = "hello"  # string
print(x)  # prints "hello"

3. Exception handling: Python has built-in support for exception handling using try, except, and finally blocks. For example:

try:
x = 1 / 0  # raises ZeroDivisionError
except ZeroDivisionError:
print("Cannot divide by zero!")

4. List comprehensions: Python has a concise way to create lists using list comprehensions. For example:

squares = [x**2 for x in range(10)]
print(squares)  # prints [0, 1, 4, 9, 16, 25, 36, 49, 64, 81]

5. Dictionary comprehensions: Similar to list comprehensions, Python has dictionary comprehensions to create dictionaries. For example:

names = {"John": 30, "Mary": 25}
print({name: age**2 for name, age in names.items()})
prints {"John": 900, "Mary": 625}

6. Modules and packages: Python has a rich ecosystem of libraries and frameworks that can be easily imported using the import statement. For example:

import math
print(math.pi)  # prints approximately 3.14159

7. Generators: Python has built-in support for generators, which allow you to create iterators that yield values on-the-fly. For example:

def fibonacci(n):
a, b = 0, 1
for _ in range(n):
yield a
a, b = b, a + b
print(list(fibonacci(10)))  # prints [0, 1, 1, 2, 3, 5, 8, 13, 21, 34]

8. Lambda functions: Python has lambda functions that allow you to define small, one-line functions. For example:

add = lambda x, y: x + y
print(add(2, 3))  # prints 5

9. Context managers: Python has built-in support for context managers using the with statement, which allows you to manage resources such as files or database connections. For example:

import os
with open("example.txt", "w") as f:
f.write("Hello World!")
print(os.path.exists("example.txt"))  # prints True

10. Coroutines: Python has built-in support for coroutines using the async and await keywords, which allow you to write asynchronous code that can be paused and resumed at specific points. For example:

import asyncio
async def say_hello(name):
print(f"Hello, {name}!")
await asyncio.sleep(1)
print(f"{name} says goodbye!")
asyncio.run(say_hello("John"))  # prints "Hello, John!", then pauses for 1 second, and finally prints "John says goodbye!"

These are just a few examples of the many features that make Python an attractive language for beginners and experts alike. With its simplicity, flexibility, and extensive libraries, Python is a great choice for building a wide range of applications, from web development to data analysis to artificial intelligence.

Note: The above examples are in Python 3.x syntax. For Python 2.x, some of the code may need slight modifications.